C21H19FN2O6 — CID 7724325
[2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate (PubChem CID 7724325) has the molecular formula C21H19FN2O6 and a molecular weight of 414.39 g/mol. Its IUPAC name is [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate.
| Compound Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7724325 |
| Molecular Formula | C21H19FN2O6 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [2-[2-(2-fluorobenzoyl)hydrazinyl]-2-oxoethyl] (E)-3-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc2c(c1)OCCCO2)NNC(=O)c1ccccc1F |
| InChI | InChI=1S/C21H19FN2O6/c22-16-5-2-1-4-15(16)21(27)24-23-19(25)13-30-20(26)9-7-14-6-8-17-18(12-14)29-11-3-10-28-17/h1-2,4-9,12H,3,10-11,13H2,(H,23,25)(H,24,27)/b9-7+ |
| InChIKey | SOBDBOXCLGXIHR-VQHVLOKHSA-N |
| XLogP | 2.00 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|