C15H14F3NO5 — CID 71954365
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 71954365) has the molecular formula C15H14F3NO5 and a molecular weight of 345.27 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 71954365 |
| Molecular Formula | C15H14F3NO5 |
| Molecular Weight | 345.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] 3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc2c(c1)OCCO2)NCC(F)(F)F |
| InChI | InChI=1S/C15H14F3NO5/c16-15(17,18)9-19-13(20)8-24-14(21)4-2-10-1-3-11-12(7-10)23-6-5-22-11/h1-4,7H,5-6,8-9H2,(H,19,20) |
| InChIKey | USESVTXQFVKZNT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|