C21H19NO7 — CID 7623757
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 7623757) has the molecular formula C21H19NO7 and a molecular weight of 397.38 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7623757 |
| Molecular Formula | C21H19NO7 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccc2c(c1)OCCO2)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H19NO7/c23-20(22-11-15-2-5-17-19(10-15)29-13-28-17)12-27-21(24)6-3-14-1-4-16-18(9-14)26-8-7-25-16/h1-6,9-10H,7-8,11-13H2,(H,22,23)/b6-3+ |
| InChIKey | XWAMBRQEJCDEFL-ZZXKWVIFSA-N |
| XLogP | 2.06 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|