C24H27NO7 — CID 3971921
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 3971921) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3971921 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)C=Cc2ccc3c(c2)OCO3)cc1OCC |
| InChI | InChI=1S/C24H27NO7/c1-3-28-19-8-6-18(14-21(19)29-4-2)11-12-25-23(26)15-30-24(27)10-7-17-5-9-20-22(13-17)32-16-31-20/h5-10,13-14H,3-4,11-12,15-16H2,1-2H3,(H,25,26) |
| InChIKey | QPRHMBIQXNQPNM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|