C24H29NO5S — CID 3876448
[2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate (PubChem CID 3876448) has the molecular formula C24H29NO5S and a molecular weight of 443.57 g/mol. Its IUPAC name is [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3876448 |
| Molecular Formula | C24H29NO5S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [2-[2-(3,4-diethoxyphenyl)ethylamino]-2-oxoethyl] 3-(4-methylsulfanylphenyl)prop-2-enoate |
| SMILES | CCOc1ccc(CCNC(=O)COC(=O)C=Cc2ccc(SC)cc2)cc1OCC |
| InChI | InChI=1S/C24H29NO5S/c1-4-28-21-12-8-19(16-22(21)29-5-2)14-15-25-23(26)17-30-24(27)13-9-18-6-10-20(31-3)11-7-18/h6-13,16H,4-5,14-15,17H2,1-3H3,(H,25,26) |
| InChIKey | CSGQGRGFAYPSLO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|