C20H18O5 — CID 7780663
[2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 7780663) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is [2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7780663 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [2-(2,4-dimethylphenyl)-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1ccc(C(=O)COC(=O)/C=C/c2ccc3c(c2)OCO3)c(C)c1 |
| InChI | InChI=1S/C20H18O5/c1-13-3-6-16(14(2)9-13)17(21)11-23-20(22)8-5-15-4-7-18-19(10-15)25-12-24-18/h3-10H,11-12H2,1-2H3/b8-5+ |
| InChIKey | OVAMJHFKQKXDEN-VMPITWQZSA-N |
| XLogP | 3.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|