C18H13BrO5 — CID 7971731
[2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 7971731) has the molecular formula C18H13BrO5 and a molecular weight of 389.20 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7971731 |
| Molecular Formula | C18H13BrO5 |
| Molecular Weight | 389.20 g/mol |
| Exact Mass | 387.99 |
| IUPAC Name | [2-(1,3-benzodioxol-5-yl)-2-oxoethyl] (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc(Br)cc1)OCC(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H13BrO5/c19-14-5-1-12(2-6-14)3-8-18(21)22-10-15(20)13-4-7-16-17(9-13)24-11-23-16/h1-9H,10-11H2/b8-3+ |
| InChIKey | SYXRRPCHQBJFPK-FPYGCLRLSA-N |
| XLogP | 3.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|