C17H12BrFO4 — CID 8705052
(4-bromo-2-fluorophenyl)methyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8705052) has the molecular formula C17H12BrFO4 and a molecular weight of 379.18 g/mol. Its IUPAC name is (4-bromo-2-fluorophenyl)methyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | (4-bromo-2-fluorophenyl)methyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8705052 |
| Molecular Formula | C17H12BrFO4 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | (4-bromo-2-fluorophenyl)methyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)OCc1ccc(Br)cc1F |
| InChI | InChI=1S/C17H12BrFO4/c18-13-4-3-12(14(19)8-13)9-21-17(20)6-2-11-1-5-15-16(7-11)23-10-22-15/h1-8H,9-10H2/b6-2+ |
| InChIKey | AJQHCXVONVFQDH-QHHAFSJGSA-N |
| XLogP | 4.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|