C19H15BrO5 — CID 7780664
[(2S)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 7780664) has the molecular formula C19H15BrO5 and a molecular weight of 403.23 g/mol. Its IUPAC name is [(2S)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7780664 |
| Molecular Formula | C19H15BrO5 |
| Molecular Weight | 403.23 g/mol |
| Exact Mass | 402.01 |
| IUPAC Name | [(2S)-1-(4-bromophenyl)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc2c(c1)OCO2)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H15BrO5/c1-12(19(22)14-4-6-15(20)7-5-14)25-18(21)9-3-13-2-8-16-17(10-13)24-11-23-16/h2-10,12H,11H2,1H3/b9-3+/t12-/m0/s1 |
| InChIKey | QRWCIRWFBGEOTR-KBNZMGLGSA-N |
| XLogP | 4.01 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|