C20H17ClO5 — CID 8564986
[(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 8564986) has the molecular formula C20H17ClO5 and a molecular weight of 372.80 g/mol. Its IUPAC name is [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8564986 |
| Molecular Formula | C20H17ClO5 |
| Molecular Weight | 372.80 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | [(2S)-1-(4-chlorophenyl)-1-oxopropan-2-yl] (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc2c(c1)OCCO2)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClO5/c1-13(20(23)15-4-6-16(21)7-5-15)26-19(22)9-3-14-2-8-17-18(12-14)25-11-10-24-17/h2-9,12-13H,10-11H2,1H3/b9-3+/t13-/m0/s1 |
| InChIKey | HWRXXFSLWMMHLT-FOWFJEMPSA-N |
| XLogP | 3.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.80 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|