C20H16F2O6 — CID 16619601
[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 16619601) has the molecular formula C20H16F2O6 and a molecular weight of 390.34 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 16619601 |
| Molecular Formula | C20H16F2O6 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | Cc1ccc(OC(F)F)c(C(=O)COC(=O)/C=C/c2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C20H16F2O6/c1-12-2-5-16(28-20(21)22)14(8-12)15(23)10-25-19(24)7-4-13-3-6-17-18(9-13)27-11-26-17/h2-9,20H,10-11H2,1H3/b7-4+ |
| InChIKey | OXWQJSYGUVAJOC-QPJJXVBHSA-N |
| XLogP | 3.76 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|