C21H20F2O6 — CID 16619516
[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 16619516) has the molecular formula C21H20F2O6 and a molecular weight of 406.38 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16619516 |
| Molecular Formula | C21H20F2O6 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(/C=C/C(=O)OCC(=O)c2cc(C)ccc2OC(F)F)cc1OC |
| InChI | InChI=1S/C21H20F2O6/c1-13-4-7-17(29-21(22)23)15(10-13)16(24)12-28-20(25)9-6-14-5-8-18(26-2)19(11-14)27-3/h4-11,21H,12H2,1-3H3/b9-6+ |
| InChIKey | NDDLUNZMXWGEHP-RMKNXTFCSA-N |
| XLogP | 4.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|