C21H19ClF2O6 — CID 16619414
[2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 16619414) has the molecular formula C21H19ClF2O6 and a molecular weight of 440.83 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 16619414 |
| Molecular Formula | C21H19ClF2O6 |
| Molecular Weight | 440.83 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [2-[2-(difluoromethoxy)-5-methylphenyl]-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)c2cc(C)ccc2OC(F)F)cc(Cl)c1OC |
| InChI | InChI=1S/C21H19ClF2O6/c1-12-4-6-17(30-21(23)24)14(8-12)16(25)11-29-19(26)7-5-13-9-15(22)20(28-3)18(10-13)27-2/h4-10,21H,11H2,1-3H3/b7-5+ |
| InChIKey | KNSIWKCNTBQDIT-FNORWQNLSA-N |
| XLogP | 4.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.83 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|