C14H13ClO2S — CID 60662425
2-(3-chlorophenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone (PubChem CID 60662425) has the molecular formula C14H13ClO2S and a molecular weight of 280.78 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone.
| Compound Name | 2-(3-chlorophenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 60662425 |
| Molecular Formula | C14H13ClO2S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(3-chlorophenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)COc2cccc(Cl)c2)c(C)s1 |
| InChI | InChI=1S/C14H13ClO2S/c1-9-6-13(10(2)18-9)14(16)8-17-12-5-3-4-11(15)7-12/h3-7H,8H2,1-2H3 |
| InChIKey | YLXWMUUEBCQKSD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |