C21H18O3S — CID 7604377
2-(4-benzoylphenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone (PubChem CID 7604377) has the molecular formula C21H18O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-(4-benzoylphenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone.
| Compound Name | 2-(4-benzoylphenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 7604377 |
| Molecular Formula | C21H18O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(4-benzoylphenoxy)-1-(2,5-dimethylthiophen-3-yl)ethanone |
| SMILES | Cc1cc(C(=O)COc2ccc(C(=O)c3ccccc3)cc2)c(C)s1 |
| InChI | InChI=1S/C21H18O3S/c1-14-12-19(15(2)25-14)20(22)13-24-18-10-8-17(9-11-18)21(23)16-6-4-3-5-7-16/h3-12H,13H2,1-2H3 |
| InChIKey | YKPKLEFYSGALHT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |