C19H16OS — CID 102480096
[4-(2,5-dimethylthiophen-3-yl)phenyl]-phenylmethanone (PubChem CID 102480096) has the molecular formula C19H16OS and a molecular weight of 292.40 g/mol. Its IUPAC name is [4-(2,5-dimethylthiophen-3-yl)phenyl]-phenylmethanone.
| Compound Name | [4-(2,5-dimethylthiophen-3-yl)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 102480096 |
| Molecular Formula | C19H16OS |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | [4-(2,5-dimethylthiophen-3-yl)phenyl]-phenylmethanone |
| SMILES | Cc1cc(-c2ccc(C(=O)c3ccccc3)cc2)c(C)s1 |
| InChI | InChI=1S/C19H16OS/c1-13-12-18(14(2)21-13)15-8-10-17(11-9-15)19(20)16-6-4-3-5-7-16/h3-12H,1-2H3 |
| InChIKey | WQHSNOAXQWHYSR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |