C20H16O3S — CID 162734980
2,5-dimethyl-4-(4-phenylbenzoyl)thiophene-3-carboxylic acid (PubChem CID 162734980) has the molecular formula C20H16O3S and a molecular weight of 336.41 g/mol. Its IUPAC name is 2,5-dimethyl-4-(4-phenylbenzoyl)thiophene-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-4-(4-phenylbenzoyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 162734980 |
| Molecular Formula | C20H16O3S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2,5-dimethyl-4-(4-phenylbenzoyl)thiophene-3-carboxylic acid |
| SMILES | Cc1sc(C)c(C(=O)c2ccc(-c3ccccc3)cc2)c1C(=O)O |
| InChI | InChI=1S/C20H16O3S/c1-12-17(18(20(22)23)13(2)24-12)19(21)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h3-11H,1-2H3,(H,22,23) |
| InChIKey | NOHWJMNXLDTXKK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |