About sodium;hydride;4-phenylbenzoic acid
sodium;hydride;4-phenylbenzoic acid (PubChem CID 173392993) has the molecular formula C13H11NaO2
and a molecular weight of 222.22 g/mol. Its IUPAC name is sodium;hydride;4-phenylbenzoic acid.
Molecular Properties
| Compound Name | sodium;hydride;4-phenylbenzoic acid |
| PubChem CID | 173392993 |
| Molecular Formula | C13H11NaO2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | sodium;hydride;4-phenylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccccc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C13H10O2.Na.H/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;;/h1-9H,(H,14,15);;/q;+1;-1 |
| InChIKey | WVLPFYWZEFNKBY-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;hydride;4-phenylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-phenylbenzoic acid?
The IUPAC name of sodium;hydride;4-phenylbenzoic acid (CID 173392993) is sodium;hydride;4-phenylbenzoic acid.
What is the SMILES notation for sodium;hydride;4-phenylbenzoic acid?
The canonical SMILES for sodium;hydride;4-phenylbenzoic acid is O=C(O)c1ccc(-c2ccccc2)cc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-phenylbenzoic acid?
The InChIKey is WVLPFYWZEFNKBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2.Na.H/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;;/h1-9H,(H,14,15);;/q;+1;-1.
What are the key properties of sodium;hydride;4-phenylbenzoic acid?
sodium;hydride;4-phenylbenzoic acid has a molecular weight of 222.22 g/mol, XLogP of 0.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-phenylbenzoic acid is sourced from PubChem (CID 173392993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).