About 4-phenylbenzoic acid;piperidine
4-phenylbenzoic acid;piperidine (PubChem CID 67667753) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-phenylbenzoic acid;piperidine.
Molecular Properties
| Compound Name | 4-phenylbenzoic acid;piperidine |
| PubChem CID | 67667753 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-phenylbenzoic acid;piperidine |
| SMILES | C1CCNCC1.O=C(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O2.C5H11N/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-4-6-5-3-1/h1-9H,(H,14,15);6H,1-5H2 |
| InChIKey | XZACCMTUJVOPCH-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenylbenzoic acid;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzoic acid;piperidine?
The IUPAC name of 4-phenylbenzoic acid;piperidine (CID 67667753) is 4-phenylbenzoic acid;piperidine.
What is the SMILES notation for 4-phenylbenzoic acid;piperidine?
The canonical SMILES for 4-phenylbenzoic acid;piperidine is C1CCNCC1.O=C(O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylbenzoic acid;piperidine?
The InChIKey is XZACCMTUJVOPCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2.C5H11N/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;1-2-4-6-5-3-1/h1-9H,(H,14,15);6H,1-5H2.
What are the key properties of 4-phenylbenzoic acid;piperidine?
4-phenylbenzoic acid;piperidine has a molecular weight of 283.37 g/mol, XLogP of 3.81, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzoic acid;piperidine is sourced from PubChem (CID 67667753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).