About aziridine-2-carbonitrile;4-phenylbenzoic acid
aziridine-2-carbonitrile;4-phenylbenzoic acid (PubChem CID 88741097) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is aziridine-2-carbonitrile;4-phenylbenzoic acid.
Molecular Properties
| Compound Name | aziridine-2-carbonitrile;4-phenylbenzoic acid |
| PubChem CID | 88741097 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | aziridine-2-carbonitrile;4-phenylbenzoic acid |
| SMILES | N#CC1CN1.O=C(O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O2.C3H4N2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;4-1-3-2-5-3/h1-9H,(H,14,15);3,5H,2H2 |
| InChIKey | JVJGRDIXFUBAIK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridine-2-carbonitrile;4-phenylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridine-2-carbonitrile;4-phenylbenzoic acid?
The IUPAC name of aziridine-2-carbonitrile;4-phenylbenzoic acid (CID 88741097) is aziridine-2-carbonitrile;4-phenylbenzoic acid.
What is the SMILES notation for aziridine-2-carbonitrile;4-phenylbenzoic acid?
The canonical SMILES for aziridine-2-carbonitrile;4-phenylbenzoic acid is N#CC1CN1.O=C(O)c1ccc(-c2ccccc2)cc1.
What is the InChIKey of aziridine-2-carbonitrile;4-phenylbenzoic acid?
The InChIKey is JVJGRDIXFUBAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2.C3H4N2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10;4-1-3-2-5-3/h1-9H,(H,14,15);3,5H,2H2.
What are the key properties of aziridine-2-carbonitrile;4-phenylbenzoic acid?
aziridine-2-carbonitrile;4-phenylbenzoic acid has a molecular weight of 266.30 g/mol, XLogP of 2.53, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aziridine-2-carbonitrile;4-phenylbenzoic acid is sourced from PubChem (CID 88741097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).