C16H14Cl2O3 — CID 62335593
1-(2,4-dichlorophenyl)-2-(3-ethoxyphenoxy)ethanone (PubChem CID 62335593) has the molecular formula C16H14Cl2O3 and a molecular weight of 325.19 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(3-ethoxyphenoxy)ethanone.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(3-ethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 62335593 |
| Molecular Formula | C16H14Cl2O3 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(3-ethoxyphenoxy)ethanone |
| SMILES | CCOc1cccc(OCC(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C16H14Cl2O3/c1-2-20-12-4-3-5-13(9-12)21-10-16(19)14-7-6-11(17)8-15(14)18/h3-9H,2,10H2,1H3 |
| InChIKey | VCPZHSNGIQAKNX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |