C19H19N3O4S — CID 24645648
N'-[2-(2-cyanophenoxy)acetyl]-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanehydrazide (PubChem CID 24645648) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N'-[2-(2-cyanophenoxy)acetyl]-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanehydrazide.
| Compound Name | N'-[2-(2-cyanophenoxy)acetyl]-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanehydrazide |
|---|---|
| PubChem CID | 24645648 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N'-[2-(2-cyanophenoxy)acetyl]-4-(2,5-dimethylthiophen-3-yl)-4-oxobutanehydrazide |
| SMILES | Cc1cc(C(=O)CCC(=O)NNC(=O)COc2ccccc2C#N)c(C)s1 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-9-15(13(2)27-12)16(23)7-8-18(24)21-22-19(25)11-26-17-6-4-3-5-14(17)10-20/h3-6,9H,7-8,11H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | YILFYNKVYPNVKT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|