C19H18N4O4S — CID 4849396
N'-[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide (PubChem CID 4849396) has the molecular formula C19H18N4O4S and a molecular weight of 398.44 g/mol. Its IUPAC name is N'-[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide.
| Compound Name | N'-[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 4849396 |
| Molecular Formula | C19H18N4O4S |
| Molecular Weight | 398.44 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N'-[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]-4-oxo-3H-phthalazine-1-carbohydrazide |
| SMILES | Cc1cc(C(=O)CCC(=O)NNC(=O)c2n[nH]c(=O)c3ccccc23)c(C)s1 |
| InChI | InChI=1S/C19H18N4O4S/c1-10-9-14(11(2)28-10)15(24)7-8-16(25)20-23-19(27)17-12-5-3-4-6-13(12)18(26)22-21-17/h3-6,9H,7-8H2,1-2H3,(H,20,25)(H,22,26)(H,23,27) |
| InChIKey | SQWXUMCCVGPCTO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|