C17H18FN3O2S2 — CID 9469366
1-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 9469366) has the molecular formula C17H18FN3O2S2 and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9469366 |
| Molecular Formula | C17H18FN3O2S2 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 1-[[4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoyl]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | Cc1cc(C(=O)CCC(=O)NNC(=S)Nc2ccc(F)cc2)c(C)s1 |
| InChI | InChI=1S/C17H18FN3O2S2/c1-10-9-14(11(2)25-10)15(22)7-8-16(23)20-21-17(24)19-13-5-3-12(18)4-6-13/h3-6,9H,7-8H2,1-2H3,(H,20,23)(H2,19,21,24) |
| InChIKey | GYHZLYPERZEQHM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|