C22H21NO2S — CID 7969004
4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-(4-phenylphenyl)butanamide (PubChem CID 7969004) has the molecular formula C22H21NO2S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-(4-phenylphenyl)butanamide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-(4-phenylphenyl)butanamide |
|---|---|
| PubChem CID | 7969004 |
| Molecular Formula | C22H21NO2S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-(4-phenylphenyl)butanamide |
| SMILES | Cc1cc(C(=O)CCC(=O)Nc2ccc(-c3ccccc3)cc2)c(C)s1 |
| InChI | InChI=1S/C22H21NO2S/c1-15-14-20(16(2)26-15)21(24)12-13-22(25)23-19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-11,14H,12-13H2,1-2H3,(H,23,25) |
| InChIKey | QNFHCIRZRBEJNQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |