C15H16N2O2S — CID 27700487
4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-pyridin-4-ylbutanamide (PubChem CID 27700487) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-pyridin-4-ylbutanamide.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 27700487 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-4-oxo-N-pyridin-4-ylbutanamide |
| SMILES | Cc1cc(C(=O)CCC(=O)Nc2ccncc2)c(C)s1 |
| InChI | InChI=1S/C15H16N2O2S/c1-10-9-13(11(2)20-10)14(18)3-4-15(19)17-12-5-7-16-8-6-12/h5-9H,3-4H2,1-2H3,(H,16,17,19) |
| InChIKey | FJYYHNRHIIPKSE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |