C20H23F3N4O2S — CID 46473778
2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide (PubChem CID 46473778) has the molecular formula C20H23F3N4O2S and a molecular weight of 440.49 g/mol. Its IUPAC name is 2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide.
| Compound Name | 2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide |
|---|---|
| PubChem CID | 46473778 |
| Molecular Formula | C20H23F3N4O2S |
| Molecular Weight | 440.49 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[2-(3-methylanilino)-2-oxoethyl]sulfanyl-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]acetamide |
| SMILES | Cc1cccc(NC(=O)CSCC(=O)NCCCNc2ccc(C(F)(F)F)cn2)c1 |
| InChI | InChI=1S/C20H23F3N4O2S/c1-14-4-2-5-16(10-14)27-19(29)13-30-12-18(28)25-9-3-8-24-17-7-6-15(11-26-17)20(21,22)23/h2,4-7,10-11H,3,8-9,12-13H2,1H3,(H,24,26)(H,25,28)(H,27,29) |
| InChIKey | UXPQBIRNTBKQJY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|