C14H17F3N6O — CID 94026449
(2S)-2-(1,2,4-triazol-1-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]propanamide (PubChem CID 94026449) has the molecular formula C14H17F3N6O and a molecular weight of 342.33 g/mol. Its IUPAC name is (2S)-2-(1,2,4-triazol-1-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]propanamide.
| Compound Name | (2S)-2-(1,2,4-triazol-1-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]propanamide |
|---|---|
| PubChem CID | 94026449 |
| Molecular Formula | C14H17F3N6O |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (2S)-2-(1,2,4-triazol-1-yl)-N-[3-[[5-(trifluoromethyl)-2-pyridinyl]amino]propyl]propanamide |
| SMILES | C[C@@H](C(=O)NCCCNc1ccc(C(F)(F)F)cn1)n1cncn1 |
| InChI | InChI=1S/C14H17F3N6O/c1-10(23-9-18-8-22-23)13(24)20-6-2-5-19-12-4-3-11(7-21-12)14(15,16)17/h3-4,7-10H,2,5-6H2,1H3,(H,19,21)(H,20,24)/t10-/m0/s1 |
| InChIKey | ISAUDLFCMDHHMN-JTQLQIEISA-N |
| XLogP | 1.87 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|