C16H23F3N4O3S — CID 97012247
(2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide (PubChem CID 97012247) has the molecular formula C16H23F3N4O3S and a molecular weight of 408.45 g/mol. Its IUPAC name is (2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide.
| Compound Name | (2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide |
|---|---|
| PubChem CID | 97012247 |
| Molecular Formula | C16H23F3N4O3S |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (2R)-2-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-methyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]butanamide |
| SMILES | CC(C)[C@H](C(=O)NCCNc1ccc(C(F)(F)F)cn1)N1CCCS1(=O)=O |
| InChI | InChI=1S/C16H23F3N4O3S/c1-11(2)14(23-8-3-9-27(23,25)26)15(24)21-7-6-20-13-5-4-12(10-22-13)16(17,18)19/h4-5,10-11,14H,3,6-9H2,1-2H3,(H,20,22)(H,21,24)/t14-/m1/s1 |
| InChIKey | PYLGXZUIYSJULD-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|