C19H19F3N4O — CID 46423302
2-(2-methyl-1H-indol-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 46423302) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-(2-methyl-1H-indol-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-(2-methyl-1H-indol-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 46423302 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-(2-methyl-1H-indol-3-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | Cc1[nH]c2ccccc2c1CC(=O)NCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H19F3N4O/c1-12-15(14-4-2-3-5-16(14)26-12)10-18(27)24-9-8-23-17-7-6-13(11-25-17)19(20,21)22/h2-7,11,26H,8-10H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | UTPSHQJBJXXYIQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|