C15H14F3N7O — CID 51122329
2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 51122329) has the molecular formula C15H14F3N7O and a molecular weight of 365.32 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | 2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 51122329 |
| Molecular Formula | C15H14F3N7O |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-([1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | O=C(Cc1nc2ncccn2n1)NCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H14F3N7O/c16-15(17,18)10-2-3-11(22-9-10)19-5-6-20-13(26)8-12-23-14-21-4-1-7-25(14)24-12/h1-4,7,9H,5-6,8H2,(H,19,22)(H,20,26) |
| InChIKey | IFUQGPAZPTXFEH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 97.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|