C19H17F3N4OS — CID 55617594
4-methyl-2-phenyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 55617594) has the molecular formula C19H17F3N4OS and a molecular weight of 406.43 g/mol. Its IUPAC name is 4-methyl-2-phenyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-2-phenyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55617594 |
| Molecular Formula | C19H17F3N4OS |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-methyl-2-phenyl-N-[2-[[5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(=O)NCCNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H17F3N4OS/c1-12-16(28-18(26-12)13-5-3-2-4-6-13)17(27)24-10-9-23-15-8-7-14(11-25-15)19(20,21)22/h2-8,11H,9-10H2,1H3,(H,23,25)(H,24,27) |
| InChIKey | YWTVQTSLUBVAPN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|