C23H28N6OS — CID 122326307
4-methyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 122326307) has the molecular formula C23H28N6OS and a molecular weight of 436.59 g/mol. Its IUPAC name is 4-methyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 122326307 |
| Molecular Formula | C23H28N6OS |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-methyl-N-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(NCCNC(=O)c2sc(-c3ccccc3)nc2C)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H28N6OS/c1-16-21(31-23(26-16)18-9-5-3-6-10-18)22(30)25-12-11-24-19-15-20(28-17(2)27-19)29-13-7-4-8-14-29/h3,5-6,9-10,15H,4,7-8,11-14H2,1-2H3,(H,25,30)(H,24,27,28) |
| InChIKey | UTCRZLUKSGXYRX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|