C20H28N6O — CID 122326346
1-(2-methylphenyl)-3-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]urea (PubChem CID 122326346) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]urea.
| Compound Name | 1-(2-methylphenyl)-3-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]urea |
|---|---|
| PubChem CID | 122326346 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 1-(2-methylphenyl)-3-[2-[(2-methyl-6-piperidin-1-ylpyrimidin-4-yl)amino]ethyl]urea |
| SMILES | Cc1nc(NCCNC(=O)Nc2ccccc2C)cc(N2CCCCC2)n1 |
| InChI | InChI=1S/C20H28N6O/c1-15-8-4-5-9-17(15)25-20(27)22-11-10-21-18-14-19(24-16(2)23-18)26-12-6-3-7-13-26/h4-5,8-9,14H,3,6-7,10-13H2,1-2H3,(H,21,23,24)(H2,22,25,27) |
| InChIKey | ZYTAVUSQARFXEZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|