C21H20F3N3O4S2 — CID 46542533
N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 46542533) has the molecular formula C21H20F3N3O4S2 and a molecular weight of 499.54 g/mol. Its IUPAC name is N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 46542533 |
| Molecular Formula | C21H20F3N3O4S2 |
| Molecular Weight | 499.54 g/mol |
| Exact Mass | 499.08 |
| IUPAC Name | N-[2-[(4-methoxyphenyl)sulfonylamino]ethyl]-4-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)NCCNC(=O)c2sc(-c3ccc(C(F)(F)F)cc3)nc2C)cc1 |
| InChI | InChI=1S/C21H20F3N3O4S2/c1-13-18(32-20(27-13)14-3-5-15(6-4-14)21(22,23)24)19(28)25-11-12-26-33(29,30)17-9-7-16(31-2)8-10-17/h3-10,26H,11-12H2,1-2H3,(H,25,28) |
| InChIKey | FSZDDGSVTZQUDK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.54 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|