C17H16F6N2O2S — CID 78858497
4-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide (PubChem CID 78858497) has the molecular formula C17H16F6N2O2S and a molecular weight of 426.38 g/mol. Its IUPAC name is 4-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 78858497 |
| Molecular Formula | C17H16F6N2O2S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | 4-methyl-N-[3-(2,2,2-trifluoroethoxy)propyl]-2-[4-(trifluoromethyl)phenyl]-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(C(F)(F)F)cc2)sc1C(=O)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C17H16F6N2O2S/c1-10-13(14(26)24-7-2-8-27-9-16(18,19)20)28-15(25-10)11-3-5-12(6-4-11)17(21,22)23/h3-6H,2,7-9H2,1H3,(H,24,26) |
| InChIKey | BKGPYIGUCLJXSY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|