C16H19FN2O2S — CID 108788207
2-(4-fluorophenyl)-N-(5-hydroxypentyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 108788207) has the molecular formula C16H19FN2O2S and a molecular weight of 322.40 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(5-hydroxypentyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(5-hydroxypentyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 108788207 |
| Molecular Formula | C16H19FN2O2S |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(5-hydroxypentyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NCCCCCO |
| InChI | InChI=1S/C16H19FN2O2S/c1-11-14(15(21)18-9-3-2-4-10-20)22-16(19-11)12-5-7-13(17)8-6-12/h5-8,20H,2-4,9-10H2,1H3,(H,18,21) |
| InChIKey | NBFZCPRYPUJHAD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|