C17H17FN4OS — CID 42536427
2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 42536427) has the molecular formula C17H17FN4OS and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 42536427 |
| Molecular Formula | C17H17FN4OS |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccc(F)cc2)sc1C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C17H17FN4OS/c1-12-15(16(23)20-7-2-9-22-10-8-19-11-22)24-17(21-12)13-3-5-14(18)6-4-13/h3-6,8,10-11H,2,7,9H2,1H3,(H,20,23) |
| InChIKey | QWVNAGGTJSYKMN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|