C20H18FN5O2 — CID 44821715
6-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 44821715) has the molecular formula C20H18FN5O2 and a molecular weight of 379.40 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 44821715 |
| Molecular Formula | C20H18FN5O2 |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)-3-methyl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1noc2nc(-c3ccc(F)cc3)cc(C(=O)NCCCn3ccnc3)c12 |
| InChI | InChI=1S/C20H18FN5O2/c1-13-18-16(19(27)23-7-2-9-26-10-8-22-12-26)11-17(24-20(18)28-25-13)14-3-5-15(21)6-4-14/h3-6,8,10-12H,2,7,9H2,1H3,(H,23,27) |
| InChIKey | IEEDRRKQEPOEJF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|