C18H20FN5OS — CID 72545366
2-[(4-fluorophenyl)methyl-methylamino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 72545366) has the molecular formula C18H20FN5OS and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-methylamino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-methylamino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 72545366 |
| Molecular Formula | C18H20FN5OS |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-methylamino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CN(Cc1ccc(F)cc1)c1ncc(C(=O)NCCCn2ccnc2)s1 |
| InChI | InChI=1S/C18H20FN5OS/c1-23(12-14-3-5-15(19)6-4-14)18-22-11-16(26-18)17(25)21-7-2-9-24-10-8-20-13-24/h3-6,8,10-11,13H,2,7,9,12H2,1H3,(H,21,25) |
| InChIKey | ADMHNTFYWRWMGU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|