C23H27N5O5S — CID 90013452
2-[2-(1,3-benzodioxol-5-yl)ethyl-(3-methoxypropanoyl)amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 90013452) has the molecular formula C23H27N5O5S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethyl-(3-methoxypropanoyl)amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl-(3-methoxypropanoyl)amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90013452 |
| Molecular Formula | C23H27N5O5S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl-(3-methoxypropanoyl)amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | COCCC(=O)N(CCc1ccc2c(c1)OCO2)c1ncc(C(=O)NCCCn2ccnc2)s1 |
| InChI | InChI=1S/C23H27N5O5S/c1-31-12-6-21(29)28(10-5-17-3-4-18-19(13-17)33-16-32-18)23-26-14-20(34-23)22(30)25-7-2-9-27-11-8-24-15-27/h3-4,8,11,13-15H,2,5-7,9-10,12,16H2,1H3,(H,25,30) |
| InChIKey | ZEAUKIYLNNGCBG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|