C24H27FN6O2S — CID 72546332
2-[[2-(3,6-dihydro-2H-pyridin-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 72546332) has the molecular formula C24H27FN6O2S and a molecular weight of 482.59 g/mol. Its IUPAC name is 2-[[2-(3,6-dihydro-2H-pyridin-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[2-(3,6-dihydro-2H-pyridin-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 72546332 |
| Molecular Formula | C24H27FN6O2S |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-[[2-(3,6-dihydro-2H-pyridin-1-yl)acetyl]-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cnc(N(Cc2ccc(F)cc2)C(=O)CN2CC=CCC2)s1 |
| InChI | InChI=1S/C24H27FN6O2S/c25-20-7-5-19(6-8-20)16-31(22(32)17-29-11-2-1-3-12-29)24-28-15-21(34-24)23(33)27-9-4-13-30-14-10-26-18-30/h1-2,5-8,10,14-15,18H,3-4,9,11-13,16-17H2,(H,27,33) |
| InChIKey | GTUHHIAWNJUOAD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|