C26H32FN7O2S — CID 86763841
2-[(4-fluorophenyl)methyl-[2-(4-prop-2-enylpiperazin-1-yl)acetyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 86763841) has the molecular formula C26H32FN7O2S and a molecular weight of 525.65 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl-[2-(4-prop-2-enylpiperazin-1-yl)acetyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(4-fluorophenyl)methyl-[2-(4-prop-2-enylpiperazin-1-yl)acetyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 86763841 |
| Molecular Formula | C26H32FN7O2S |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl-[2-(4-prop-2-enylpiperazin-1-yl)acetyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | C=CCN1CCN(CC(=O)N(Cc2ccc(F)cc2)c2ncc(C(=O)NCCCn3ccnc3)s2)CC1 |
| InChI | InChI=1S/C26H32FN7O2S/c1-2-10-31-13-15-32(16-14-31)19-24(35)34(18-21-4-6-22(27)7-5-21)26-30-17-23(37-26)25(36)29-8-3-11-33-12-9-28-20-33/h2,4-7,9,12,17,20H,1,3,8,10-11,13-16,18-19H2,(H,29,36) |
| InChIKey | DJOSIHPFOFVUMK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|