C22H25FN6O3S — CID 86764061
2-[[(4-fluorophenyl)methyl-(oxolan-3-yl)carbamoyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 86764061) has the molecular formula C22H25FN6O3S and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[[(4-fluorophenyl)methyl-(oxolan-3-yl)carbamoyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[[(4-fluorophenyl)methyl-(oxolan-3-yl)carbamoyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 86764061 |
| Molecular Formula | C22H25FN6O3S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-[[(4-fluorophenyl)methyl-(oxolan-3-yl)carbamoyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cnc(NC(=O)N(Cc2ccc(F)cc2)C2CCOC2)s1 |
| InChI | InChI=1S/C22H25FN6O3S/c23-17-4-2-16(3-5-17)13-29(18-6-11-32-14-18)22(31)27-21-26-12-19(33-21)20(30)25-7-1-9-28-10-8-24-15-28/h2-5,8,10,12,15,18H,1,6-7,9,11,13-14H2,(H,25,30)(H,26,27,31) |
| InChIKey | DOWGTWGBERKJIM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|