C24H22Cl2FN5OS — CID 72546097
2-[(2,5-dichlorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 72546097) has the molecular formula C24H22Cl2FN5OS and a molecular weight of 518.45 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 72546097 |
| Molecular Formula | C24H22Cl2FN5OS |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl-[(4-fluorophenyl)methyl]amino]-N-(3-imidazol-1-ylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cnc(N(Cc2ccc(F)cc2)Cc2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C24H22Cl2FN5OS/c25-19-4-7-21(26)18(12-19)15-32(14-17-2-5-20(27)6-3-17)24-30-13-22(34-24)23(33)29-8-1-10-31-11-9-28-16-31/h2-7,9,11-13,16H,1,8,10,14-15H2,(H,29,33) |
| InChIKey | HDPFSQGDVLERTG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|