C20H24N6O3S — CID 90012972
N-(3-imidazol-1-ylpropyl)-2-[2-methoxyethyl-(2-pyridin-2-ylacetyl)amino]-1,3-thiazole-5-carboxamide (PubChem CID 90012972) has the molecular formula C20H24N6O3S and a molecular weight of 428.52 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-[2-methoxyethyl-(2-pyridin-2-ylacetyl)amino]-1,3-thiazole-5-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-[2-methoxyethyl-(2-pyridin-2-ylacetyl)amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 90012972 |
| Molecular Formula | C20H24N6O3S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-[2-methoxyethyl-(2-pyridin-2-ylacetyl)amino]-1,3-thiazole-5-carboxamide |
| SMILES | COCCN(C(=O)Cc1ccccn1)c1ncc(C(=O)NCCCn2ccnc2)s1 |
| InChI | InChI=1S/C20H24N6O3S/c1-29-12-11-26(18(27)13-16-5-2-3-6-22-16)20-24-14-17(30-20)19(28)23-7-4-9-25-10-8-21-15-25/h2-3,5-6,8,10,14-15H,4,7,9,11-13H2,1H3,(H,23,28) |
| InChIKey | ASFSZJSFLCJMEB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 102.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|