C12H19N3O2 — CID 119068889
N-(3-imidazol-1-ylpropyl)-2-(oxolan-3-yl)acetamide (PubChem CID 119068889) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-(oxolan-3-yl)acetamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-(oxolan-3-yl)acetamide |
|---|---|
| PubChem CID | 119068889 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-(oxolan-3-yl)acetamide |
| SMILES | O=C(CC1CCOC1)NCCCn1ccnc1 |
| InChI | InChI=1S/C12H19N3O2/c16-12(8-11-2-7-17-9-11)14-3-1-5-15-6-4-13-10-15/h4,6,10-11H,1-3,5,7-9H2,(H,14,16) |
| InChIKey | LTWNQDNDTDUTPF-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|