C12H22Cl2N4O — CID 119827227
N-(3-imidazol-1-ylpropyl)-2-pyrrolidin-2-ylacetamide;dihydrochloride (PubChem CID 119827227) has the molecular formula C12H22Cl2N4O and a molecular weight of 309.24 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-pyrrolidin-2-ylacetamide;dihydrochloride.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-pyrrolidin-2-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119827227 |
| Molecular Formula | C12H22Cl2N4O |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-pyrrolidin-2-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CCCN1)NCCCn1ccnc1 |
| InChI | InChI=1S/C12H20N4O.2ClH/c17-12(9-11-3-1-4-14-11)15-5-2-7-16-8-6-13-10-16;;/h6,8,10-11,14H,1-5,7,9H2,(H,15,17);2*1H |
| InChIKey | ANYQAKVNJHTQJO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|