C13H22N4O3S — CID 80518226
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-imidazol-1-ylbutyl)acetamide (PubChem CID 80518226) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-imidazol-1-ylbutyl)acetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-imidazol-1-ylbutyl)acetamide |
|---|---|
| PubChem CID | 80518226 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-(4-imidazol-1-ylbutyl)acetamide |
| SMILES | O=C(CC1CS(=O)(=O)CCN1)NCCCCn1ccnc1 |
| InChI | InChI=1S/C13H22N4O3S/c18-13(9-12-10-21(19,20)8-5-15-12)16-3-1-2-6-17-7-4-14-11-17/h4,7,11-12,15H,1-3,5-6,8-10H2,(H,16,18) |
| InChIKey | BUQMDJMGOZMJTQ-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|