C14H28N2O3S — CID 115568056
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-octylacetamide (PubChem CID 115568056) has the molecular formula C14H28N2O3S and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-octylacetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-octylacetamide |
|---|---|
| PubChem CID | 115568056 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-octylacetamide |
| SMILES | CCCCCCCCNC(=O)CC1CS(=O)(=O)CCN1 |
| InChI | InChI=1S/C14H28N2O3S/c1-2-3-4-5-6-7-8-16-14(17)11-13-12-20(18,19)10-9-15-13/h13,15H,2-12H2,1H3,(H,16,17) |
| InChIKey | AILGUUUVOSMDTM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|